C45H35FIrN5- — CID 140826444
9-[4-[4-[4-fluoro-6-(1,1,3,3-tetramethyl-2,6-dihydroinden-6-id-5-yl)-3-pyridinyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole;iridium (PubChem CID 140826444) has the molecular formula C45H35FIrN5- and a molecular weight of 857.03 g/mol. Its IUPAC name is 9-[4-[4-[4-fluoro-6-(1,1,3,3-tetramethyl-2,6-dihydroinden-6-id-5-yl)-3-pyridinyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole;iridium.
| Compound Name | 9-[4-[4-[4-fluoro-6-(1,1,3,3-tetramethyl-2,6-dihydroinden-6-id-5-yl)-3-pyridinyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole;iridium |
|---|---|
| PubChem CID | 140826444 |
| Molecular Formula | C45H35FIrN5- |
| Molecular Weight | 857.03 g/mol |
| Exact Mass | 857.25 |
| IUPAC Name | 9-[4-[4-[4-fluoro-6-(1,1,3,3-tetramethyl-2,6-dihydroinden-6-id-5-yl)-3-pyridinyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole;iridium |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3cc(F)c(-c4nc(-c5ccccc5)nc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)n4)cn3)[c-]cc21.[Ir] |
| InChI | InChI=1S/C45H35FN5.Ir/c1-44(2)27-45(3,4)36-24-30(20-23-35(36)44)38-25-37(46)34(26-47-38)43-49-41(28-12-6-5-7-13-28)48-42(50-43)29-18-21-31(22-19-29)51-39-16-10-8-14-32(39)33-15-9-11-17-40(33)51;/h5-19,21-26H,27H2,1-4H3;/q-1; |
| InChIKey | UCZKIJWFWCXZQS-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.03 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|