C27H34F3N5O2Si — CID 140827006
(7S)-3-[2-cyclobutyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 140827006) has the molecular formula C27H34F3N5O2Si and a molecular weight of 545.68 g/mol. Its IUPAC name is (7S)-3-[2-cyclobutyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | (7S)-3-[2-cyclobutyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 140827006 |
| Molecular Formula | C27H34F3N5O2Si |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (7S)-3-[2-cyclobutyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | C[C@H]1CN(c2ccc(C(F)(F)F)cc2)C(=O)c2c(-c3cnc(C4CCC4)n3COCC[Si](C)(C)C)cnn21 |
| InChI | InChI=1S/C27H34F3N5O2Si/c1-18-16-33(21-10-8-20(9-11-21)27(28,29)30)26(36)24-22(14-32-35(18)24)23-15-31-25(19-6-5-7-19)34(23)17-37-12-13-38(2,3)4/h8-11,14-15,18-19H,5-7,12-13,16-17H2,1-4H3/t18-/m0/s1 |
| InChIKey | FKVYHYUFHKKQCA-SFHVURJKSA-N |
| XLogP | 6.57 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|