C52H28N6O4 — CID 140828596
6-[3,5-di(carbazol-9-yl)phenyl]-2-(1,10-phenanthrolin-5-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 140828596) has the molecular formula C52H28N6O4 and a molecular weight of 800.83 g/mol. Its IUPAC name is 6-[3,5-di(carbazol-9-yl)phenyl]-2-(1,10-phenanthrolin-5-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-[3,5-di(carbazol-9-yl)phenyl]-2-(1,10-phenanthrolin-5-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 140828596 |
| Molecular Formula | C52H28N6O4 |
| Molecular Weight | 800.83 g/mol |
| Exact Mass | 800.22 |
| IUPAC Name | 6-[3,5-di(carbazol-9-yl)phenyl]-2-(1,10-phenanthrolin-5-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(-c4cc5cccnc5c5ncccc45)c(=O)c3cc2c(=O)n1-c1cc(-n2c3ccccc3c3ccccc32)cc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C52H28N6O4/c59-49-38-27-40-41(52(62)58(51(40)61)46-23-29-11-9-21-53-47(29)48-37(46)16-10-22-54-48)28-39(38)50(60)57(49)32-25-30(55-42-17-5-1-12-33(42)34-13-2-6-18-43(34)55)24-31(26-32)56-44-19-7-3-14-35(44)36-15-4-8-20-45(36)56/h1-28H |
| InChIKey | CKHYBVAWVXAUMI-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 113.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.83 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|