C27H23N3O4 — CID 140829271
4-[4-isocyano-2-[[(1'R,3S)-5-pyridin-3-ylspiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid (PubChem CID 140829271) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[4-isocyano-2-[[(1'R,3S)-5-pyridin-3-ylspiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid.
| Compound Name | 4-[4-isocyano-2-[[(1'R,3S)-5-pyridin-3-ylspiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 140829271 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[4-isocyano-2-[[(1'R,3S)-5-pyridin-3-ylspiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carbonyl]amino]phenyl]butanoic acid |
| SMILES | [C-]#[N+]c1ccc(CCCC(=O)O)c(NC(=O)[C@@H]2C[C@]23COc2ccc(-c4cccnc4)cc23)c1 |
| InChI | InChI=1S/C27H23N3O4/c1-28-20-9-7-17(4-2-6-25(31)32)23(13-20)30-26(33)22-14-27(22)16-34-24-10-8-18(12-21(24)27)19-5-3-11-29-15-19/h3,5,7-13,15,22H,2,4,6,14,16H2,(H,30,33)(H,31,32)/t22-,27+/m0/s1 |
| InChIKey | JDXVUEYZASZPLC-WXVAWEFUSA-N |
| XLogP | 5.00 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|