C19H23N3O6 — CID 140830760
ethyl 4-[(3-methoxy-3-oxopropanoyl)amino]-1-[(4-methoxyphenyl)methyl]-3-methylpyrazole-5-carboxylate (PubChem CID 140830760) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl 4-[(3-methoxy-3-oxopropanoyl)amino]-1-[(4-methoxyphenyl)methyl]-3-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(3-methoxy-3-oxopropanoyl)amino]-1-[(4-methoxyphenyl)methyl]-3-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 140830760 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 4-[(3-methoxy-3-oxopropanoyl)amino]-1-[(4-methoxyphenyl)methyl]-3-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CC(=O)OC)c(C)nn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23N3O6/c1-5-28-19(25)18-17(20-15(23)10-16(24)27-4)12(2)21-22(18)11-13-6-8-14(26-3)9-7-13/h6-9H,5,10-11H2,1-4H3,(H,20,23) |
| InChIKey | HSPMZUIHLHTBRD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|