C43H27NO — CID 140831311
2-[2-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzofuran-1-yl]pyridine (PubChem CID 140831311) has the molecular formula C43H27NO and a molecular weight of 578.73 g/mol. Its IUPAC name is 2-[2-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzofuran-1-yl]pyridine.
| Compound Name | 2-[2-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzofuran-1-yl]pyridine |
|---|---|
| PubChem CID | 140831311 |
| Molecular Formula | C43H27NO |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-[2-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzofuran-1-yl]pyridine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc(-c4ccc5oc6ccccc6c5c4-c4ccccn4)c3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C43H27NO/c1-2-13-28(14-3-1)40-32-17-4-6-19-34(32)41(35-20-7-5-18-33(35)40)30-16-12-15-29(27-30)31-24-25-39-43(36-21-8-9-23-38(36)45-39)42(31)37-22-10-11-26-44-37/h1-27H/i1D,2D,3D,13D,14D |
| InChIKey | IRVMWXXBVNGLHV-NDWIIPQNSA-N |
| XLogP | 11.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|