C56H54N3OPtS- — CID 140832043
2,4-ditert-butyl-6-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4-(3-pyridin-2-yl-2H-dibenzothiophen-2-id-1-yl)benzimidazol-2-yl]phenol;platinum (PubChem CID 140832043) has the molecular formula C56H54N3OPtS- and a molecular weight of 1012.21 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4-(3-pyridin-2-yl-2H-dibenzothiophen-2-id-1-yl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4-(3-pyridin-2-yl-2H-dibenzothiophen-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140832043 |
| Molecular Formula | C56H54N3OPtS- |
| Molecular Weight | 1012.21 g/mol |
| Exact Mass | 1011.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4-(3-pyridin-2-yl-2H-dibenzothiophen-2-id-1-yl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc2c(-c3[c-]c(-c4ccccn4)cc4sc5ccccc5c34)cccc21.[Pt] |
| InChI | InChI=1S/C56H54N3OS.Pt/c1-33(2)41-27-36(35-19-12-11-13-20-35)28-42(34(3)4)52(41)59-47-24-18-22-39(51(47)58-54(59)44-31-38(55(5,6)7)32-45(53(44)60)56(8,9)10)43-29-37(46-23-16-17-26-57-46)30-49-50(43)40-21-14-15-25-48(40)61-49;/h11-28,30-34,60H,1-10H3;/q-1; |
| InChIKey | VAFJGIKKHXZIJK-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.21 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|