C29H26N3OPt- — CID 140832061
2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1-methylbenzimidazol-2-yl]phenol;platinum (PubChem CID 140832061) has the molecular formula C29H26N3OPt- and a molecular weight of 627.63 g/mol. Its IUPAC name is 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1-methylbenzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1-methylbenzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140832061 |
| Molecular Formula | C29H26N3OPt- |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 2-[4-(3-tert-butyl-5-pyridin-2-ylbenzene-6-id-1-yl)-1-methylbenzimidazol-2-yl]phenol;platinum |
| SMILES | Cn1c(-c2ccccc2O)nc2c(-c3[c-]c(-c4ccccn4)cc(C(C)(C)C)c3)cccc21.[Pt] |
| InChI | InChI=1S/C29H26N3O.Pt/c1-29(2,3)21-17-19(16-20(18-21)24-12-7-8-15-30-24)22-11-9-13-25-27(22)31-28(32(25)4)23-10-5-6-14-26(23)33;/h5-15,17-18,33H,1-4H3;/q-1; |
| InChIKey | QYOLRCKPUYLFAR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|