About 2-ethyl-4,5-dipropyl-1H-imidazole
2-ethyl-4,5-dipropyl-1H-imidazole (PubChem CID 140833487) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-ethyl-4,5-dipropyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dipropyl-1H-imidazole |
| PubChem CID | 140833487 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-ethyl-4,5-dipropyl-1H-imidazole |
| SMILES | CCCc1nc(CC)[nH]c1CCC |
| InChI | InChI=1S/C11H20N2/c1-4-7-9-10(8-5-2)13-11(6-3)12-9/h4-8H2,1-3H3,(H,12,13) |
| InChIKey | FRURSOPIVUOXPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4,5-dipropyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dipropyl-1H-imidazole?
The IUPAC name of 2-ethyl-4,5-dipropyl-1H-imidazole (CID 140833487) is 2-ethyl-4,5-dipropyl-1H-imidazole.
What is the SMILES notation for 2-ethyl-4,5-dipropyl-1H-imidazole?
The canonical SMILES for 2-ethyl-4,5-dipropyl-1H-imidazole is CCCc1nc(CC)[nH]c1CCC.
What is the InChIKey of 2-ethyl-4,5-dipropyl-1H-imidazole?
The InChIKey is FRURSOPIVUOXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-7-9-10(8-5-2)13-11(6-3)12-9/h4-8H2,1-3H3,(H,12,13).
What are the key properties of 2-ethyl-4,5-dipropyl-1H-imidazole?
2-ethyl-4,5-dipropyl-1H-imidazole has a molecular weight of 180.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dipropyl-1H-imidazole is sourced from PubChem (CID 140833487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).