About 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole
2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole (PubChem CID 68752618) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole |
| PubChem CID | 68752618 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole |
| SMILES | CCCc1nc(C(C)(C)CC)[nH]c1CCC |
| InChI | InChI=1S/C14H26N2/c1-6-9-11-12(10-7-2)16-13(15-11)14(4,5)8-3/h6-10H2,1-5H3,(H,15,16) |
| InChIKey | QFMYKNBQBKMBAO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole?
The IUPAC name of 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole (CID 68752618) is 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole.
What is the SMILES notation for 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole?
The canonical SMILES for 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole is CCCc1nc(C(C)(C)CC)[nH]c1CCC.
What is the InChIKey of 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole?
The InChIKey is QFMYKNBQBKMBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-6-9-11-12(10-7-2)16-13(15-11)14(4,5)8-3/h6-10H2,1-5H3,(H,15,16).
What are the key properties of 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole?
2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole has a molecular weight of 222.38 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylbutan-2-yl)-4,5-dipropyl-1H-imidazole is sourced from PubChem (CID 68752618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).