C24H46N2 — CID 66722905
5-(2-methylbutan-2-yl)-2,4-bis(2-methylheptan-2-yl)-1H-imidazole (PubChem CID 66722905) has the molecular formula C24H46N2 and a molecular weight of 362.65 g/mol. Its IUPAC name is 5-(2-methylbutan-2-yl)-2,4-bis(2-methylheptan-2-yl)-1H-imidazole.
| Compound Name | 5-(2-methylbutan-2-yl)-2,4-bis(2-methylheptan-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66722905 |
| Molecular Formula | C24H46N2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.37 |
| IUPAC Name | 5-(2-methylbutan-2-yl)-2,4-bis(2-methylheptan-2-yl)-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(C)CCCCC)c(C(C)(C)CC)[nH]1 |
| InChI | InChI=1S/C24H46N2/c1-10-13-15-17-23(6,7)20-19(22(4,5)12-3)25-21(26-20)24(8,9)18-16-14-11-2/h10-18H2,1-9H3,(H,25,26) |
| InChIKey | IBZPZNOUIDEWMR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|