C21H40N2 — CID 89497192
2-(2-methylheptan-2-yl)-4-(2-methylhexan-2-yl)-5-propyl-1H-imidazole (PubChem CID 89497192) has the molecular formula C21H40N2 and a molecular weight of 320.57 g/mol. Its IUPAC name is 2-(2-methylheptan-2-yl)-4-(2-methylhexan-2-yl)-5-propyl-1H-imidazole.
| Compound Name | 2-(2-methylheptan-2-yl)-4-(2-methylhexan-2-yl)-5-propyl-1H-imidazole |
|---|---|
| PubChem CID | 89497192 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | 2-(2-methylheptan-2-yl)-4-(2-methylhexan-2-yl)-5-propyl-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(C)CCCC)c(CCC)[nH]1 |
| InChI | InChI=1S/C21H40N2/c1-8-11-13-16-21(6,7)19-22-17(14-10-3)18(23-19)20(4,5)15-12-9-2/h8-16H2,1-7H3,(H,22,23) |
| InChIKey | GTNVNMSUDGOAPH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|