C44H84N4 — CID 159059126
5-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole (PubChem CID 159059126) has the molecular formula C44H84N4 and a molecular weight of 669.18 g/mol. Its IUPAC name is 5-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole.
| Compound Name | 5-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 159059126 |
| Molecular Formula | C44H84N4 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.67 |
| IUPAC Name | 5-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(CC)CC)[nH]c1C(C)(C)CC.CCCCCC(C)(C)c1nc(C(C)(CC)CC)[nH]c1C(C)(C)CC |
| InChI | InChI=1S/2C22H42N2/c2*1-10-14-15-16-21(7,8)18-17(20(5,6)11-2)23-19(24-18)22(9,12-3)13-4/h2*10-16H2,1-9H3,(H,23,24) |
| InChIKey | JYFUVKYFXSPHIH-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|