C22H42N2 — CID 66722987
5-(3-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole (PubChem CID 66722987) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 5-(3-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole.
| Compound Name | 5-(3-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66722987 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 5-(3-methylbutan-2-yl)-4-(2-methylheptan-2-yl)-2-(3-methylpentan-3-yl)-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(CC)CC)[nH]c1C(C)C(C)C |
| InChI | InChI=1S/C22H42N2/c1-10-13-14-15-21(7,8)19-18(17(6)16(4)5)23-20(24-19)22(9,11-2)12-3/h16-17H,10-15H2,1-9H3,(H,23,24) |
| InChIKey | AKKDAQOAGNLAKS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|