C42H80N4 — CID 162062572
4-tert-butyl-2-(2-methylheptan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole (PubChem CID 162062572) has the molecular formula C42H80N4 and a molecular weight of 641.13 g/mol. Its IUPAC name is 4-tert-butyl-2-(2-methylheptan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole.
| Compound Name | 4-tert-butyl-2-(2-methylheptan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 162062572 |
| Molecular Formula | C42H80N4 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.64 |
| IUPAC Name | 4-tert-butyl-2-(2-methylheptan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(C)C)c(C(C)(CC)CC)[nH]1.CCCCCC(C)(C)c1nc(C(C)(C)C)c(C(C)(CC)CC)[nH]1 |
| InChI | InChI=1S/2C21H40N2/c2*1-10-13-14-15-20(7,8)18-22-16(19(4,5)6)17(23-18)21(9,11-2)12-3/h2*10-15H2,1-9H3,(H,22,23) |
| InChIKey | ZAAOPQHLJHYSDC-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|