C19H36N2 — CID 66723308
4-(2-methylhexan-2-yl)-2-(3-methylpentan-3-yl)-5-propan-2-yl-1H-imidazole (PubChem CID 66723308) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 4-(2-methylhexan-2-yl)-2-(3-methylpentan-3-yl)-5-propan-2-yl-1H-imidazole.
| Compound Name | 4-(2-methylhexan-2-yl)-2-(3-methylpentan-3-yl)-5-propan-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 66723308 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 4-(2-methylhexan-2-yl)-2-(3-methylpentan-3-yl)-5-propan-2-yl-1H-imidazole |
| SMILES | CCCCC(C)(C)c1nc(C(C)(CC)CC)[nH]c1C(C)C |
| InChI | InChI=1S/C19H36N2/c1-9-12-13-18(6,7)16-15(14(4)5)20-17(21-16)19(8,10-2)11-3/h14H,9-13H2,1-8H3,(H,20,21) |
| InChIKey | XKGCVRPATIWQFZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |