C20H38N2 — CID 66723353
5-(3-methylbutan-2-yl)-2-(2-methylpentan-2-yl)-4-(3-methylpentan-3-yl)-1H-imidazole (PubChem CID 66723353) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 5-(3-methylbutan-2-yl)-2-(2-methylpentan-2-yl)-4-(3-methylpentan-3-yl)-1H-imidazole.
| Compound Name | 5-(3-methylbutan-2-yl)-2-(2-methylpentan-2-yl)-4-(3-methylpentan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66723353 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 5-(3-methylbutan-2-yl)-2-(2-methylpentan-2-yl)-4-(3-methylpentan-3-yl)-1H-imidazole |
| SMILES | CCCC(C)(C)c1nc(C(C)(CC)CC)c(C(C)C(C)C)[nH]1 |
| InChI | InChI=1S/C20H38N2/c1-10-13-19(7,8)18-21-16(15(6)14(4)5)17(22-18)20(9,11-2)12-3/h14-15H,10-13H2,1-9H3,(H,21,22) |
| InChIKey | GFSBMYUPTOHDDB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |