C20H38N2 — CID 66723108
4-(2-methylhexan-2-yl)-2,5-di(pentan-2-yl)-1H-imidazole (PubChem CID 66723108) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 4-(2-methylhexan-2-yl)-2,5-di(pentan-2-yl)-1H-imidazole.
| Compound Name | 4-(2-methylhexan-2-yl)-2,5-di(pentan-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66723108 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 4-(2-methylhexan-2-yl)-2,5-di(pentan-2-yl)-1H-imidazole |
| SMILES | CCCCC(C)(C)c1nc(C(C)CCC)[nH]c1C(C)CCC |
| InChI | InChI=1S/C20H38N2/c1-8-11-14-20(6,7)18-17(15(4)12-9-2)21-19(22-18)16(5)13-10-3/h15-16H,8-14H2,1-7H3,(H,21,22) |
| InChIKey | VUAGCBPJWCDVQF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |