C19H36N2 — CID 66723018
4-tert-butyl-5-(2-methylbutan-2-yl)-2-(2-methylhexan-2-yl)-1H-imidazole (PubChem CID 66723018) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 4-tert-butyl-5-(2-methylbutan-2-yl)-2-(2-methylhexan-2-yl)-1H-imidazole.
| Compound Name | 4-tert-butyl-5-(2-methylbutan-2-yl)-2-(2-methylhexan-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66723018 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 4-tert-butyl-5-(2-methylbutan-2-yl)-2-(2-methylhexan-2-yl)-1H-imidazole |
| SMILES | CCCCC(C)(C)c1nc(C(C)(C)C)c(C(C)(C)CC)[nH]1 |
| InChI | InChI=1S/C19H36N2/c1-10-12-13-19(8,9)16-20-14(17(3,4)5)15(21-16)18(6,7)11-2/h10-13H2,1-9H3,(H,20,21) |
| InChIKey | AGKREIQKUNZHTM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |