C18H14N2O5 — CID 140833786
1-(3-hydroxy-5-methyl-4-oxo-5-quinolin-4-ylfuran-2-yl)pyrrolidine-2,5-dione (PubChem CID 140833786) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-(3-hydroxy-5-methyl-4-oxo-5-quinolin-4-ylfuran-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(3-hydroxy-5-methyl-4-oxo-5-quinolin-4-ylfuran-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 140833786 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(3-hydroxy-5-methyl-4-oxo-5-quinolin-4-ylfuran-2-yl)pyrrolidine-2,5-dione |
| SMILES | CC1(c2ccnc3ccccc23)OC(N2C(=O)CCC2=O)=C(O)C1=O |
| InChI | InChI=1S/C18H14N2O5/c1-18(11-8-9-19-12-5-3-2-4-10(11)12)16(24)15(23)17(25-18)20-13(21)6-7-14(20)22/h2-5,8-9,23H,6-7H2,1H3 |
| InChIKey | AICKQQCDNNJRAU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|