C22H18N2O6S — CID 140834438
[2-(benzenesulfonamido)-5-methyl-4-oxo-5-quinolin-4-ylfuran-3-yl] acetate (PubChem CID 140834438) has the molecular formula C22H18N2O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is [2-(benzenesulfonamido)-5-methyl-4-oxo-5-quinolin-4-ylfuran-3-yl] acetate.
| Compound Name | [2-(benzenesulfonamido)-5-methyl-4-oxo-5-quinolin-4-ylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834438 |
| Molecular Formula | C22H18N2O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [2-(benzenesulfonamido)-5-methyl-4-oxo-5-quinolin-4-ylfuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NS(=O)(=O)c2ccccc2)OC(C)(c2ccnc3ccccc23)C1=O |
| InChI | InChI=1S/C22H18N2O6S/c1-14(25)29-19-20(26)22(2,17-12-13-23-18-11-7-6-10-16(17)18)30-21(19)24-31(27,28)15-8-4-3-5-9-15/h3-13,24H,1-2H3 |
| InChIKey | HBNIOBSZZPOZNX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |