C20H19NO7S — CID 140834171
[2-(benzenesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834171) has the molecular formula C20H19NO7S and a molecular weight of 417.44 g/mol. Its IUPAC name is [2-(benzenesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-(benzenesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834171 |
| Molecular Formula | C20H19NO7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [2-(benzenesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | COc1ccccc1C1(C)OC(NS(=O)(=O)c2ccccc2)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C20H19NO7S/c1-13(22)27-17-18(23)20(2,15-11-7-8-12-16(15)26-3)28-19(17)21-29(24,25)14-9-5-4-6-10-14/h4-12,21H,1-3H3 |
| InChIKey | LYVKDPFAGUGBKD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |