C15H17NO7S — CID 140834161
[2-(methanesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834161) has the molecular formula C15H17NO7S and a molecular weight of 355.37 g/mol. Its IUPAC name is [2-(methanesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-(methanesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834161 |
| Molecular Formula | C15H17NO7S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | [2-(methanesulfonamido)-5-(2-methoxyphenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | COc1ccccc1C1(C)OC(NS(C)(=O)=O)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C15H17NO7S/c1-9(17)22-12-13(18)15(2,23-14(12)16-24(4,19)20)10-7-5-6-8-11(10)21-3/h5-8,16H,1-4H3 |
| InChIKey | JITUTCSVRDMCOX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |