About [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate
[5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140833655) has the molecular formula C14H13Cl2NO6S
and a molecular weight of 394.23 g/mol. Its IUPAC name is [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate.
Molecular Properties
| Compound Name | [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate |
| PubChem CID | 140833655 |
| Molecular Formula | C14H13Cl2NO6S |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NS(C)(=O)=O)OC(C)(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C14H13Cl2NO6S/c1-7(18)22-11-12(19)14(2,23-13(11)17-24(3,20)21)9-6-8(15)4-5-10(9)16/h4-6,17H,1-3H3 |
| InChIKey | AVDQLEPDSYXQHC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate?
The IUPAC name of [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate (CID 140833655) is [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate.
What is the SMILES notation for [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate?
The canonical SMILES for [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate is CC(=O)OC1=C(NS(C)(=O)=O)OC(C)(c2cc(Cl)ccc2Cl)C1=O.
What is the InChIKey of [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate?
The InChIKey is AVDQLEPDSYXQHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2NO6S/c1-7(18)22-11-12(19)14(2,23-13(11)17-24(3,20)21)9-6-8(15)4-5-10(9)16/h4-6,17H,1-3H3.
What are the key properties of [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate?
[5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate has a molecular weight of 394.23 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,5-dichlorophenyl)-2-(methanesulfonamido)-5-methyl-4-oxofuran-3-yl] acetate is sourced from PubChem (CID 140833655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).