C16H15ClFNO6 — CID 140834145
[5-(4-chloro-2-fluorophenyl)-2-(ethoxycarbonylamino)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834145) has the molecular formula C16H15ClFNO6 and a molecular weight of 371.75 g/mol. Its IUPAC name is [5-(4-chloro-2-fluorophenyl)-2-(ethoxycarbonylamino)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-chloro-2-fluorophenyl)-2-(ethoxycarbonylamino)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834145 |
| Molecular Formula | C16H15ClFNO6 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | [5-(4-chloro-2-fluorophenyl)-2-(ethoxycarbonylamino)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CCOC(=O)NC1=C(OC(C)=O)C(=O)C(C)(c2ccc(Cl)cc2F)O1 |
| InChI | InChI=1S/C16H15ClFNO6/c1-4-23-15(22)19-14-12(24-8(2)20)13(21)16(3,25-14)10-6-5-9(17)7-11(10)18/h5-7H,4H2,1-3H3,(H,19,22) |
| InChIKey | FRIPXPQGQKOLOM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |