C16H16BrClFNO6S — CID 140834097
[2-(3-bromopropylsulfonylamino)-5-(3-chloro-4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834097) has the molecular formula C16H16BrClFNO6S and a molecular weight of 484.73 g/mol. Its IUPAC name is [2-(3-bromopropylsulfonylamino)-5-(3-chloro-4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-(3-bromopropylsulfonylamino)-5-(3-chloro-4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834097 |
| Molecular Formula | C16H16BrClFNO6S |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | [2-(3-bromopropylsulfonylamino)-5-(3-chloro-4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NS(=O)(=O)CCCBr)OC(C)(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H16BrClFNO6S/c1-9(21)25-13-14(22)16(2,10-4-5-12(19)11(18)8-10)26-15(13)20-27(23,24)7-3-6-17/h4-5,8,20H,3,6-7H2,1-2H3 |
| InChIKey | BDIUFEKSTVRCCY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|