C16H18FNO6S — CID 175463079
[2-[ethylsulfonyl(methyl)amino]-5-(4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 175463079) has the molecular formula C16H18FNO6S and a molecular weight of 371.39 g/mol. Its IUPAC name is [2-[ethylsulfonyl(methyl)amino]-5-(4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-[ethylsulfonyl(methyl)amino]-5-(4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 175463079 |
| Molecular Formula | C16H18FNO6S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [2-[ethylsulfonyl(methyl)amino]-5-(4-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CCS(=O)(=O)N(C)C1=C(OC(C)=O)C(=O)C(C)(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C16H18FNO6S/c1-5-25(21,22)18(4)15-13(23-10(2)19)14(20)16(3,24-15)11-6-8-12(17)9-7-11/h6-9H,5H2,1-4H3 |
| InChIKey | CQAPLABNDYUIMD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |