C12H15NO5S2 — CID 174753591
N-(3-hydroxy-5-methyl-4-oxo-5-thiophen-2-ylfuran-2-yl)-N-methylethanesulfonamide (PubChem CID 174753591) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(3-hydroxy-5-methyl-4-oxo-5-thiophen-2-ylfuran-2-yl)-N-methylethanesulfonamide.
| Compound Name | N-(3-hydroxy-5-methyl-4-oxo-5-thiophen-2-ylfuran-2-yl)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 174753591 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(3-hydroxy-5-methyl-4-oxo-5-thiophen-2-ylfuran-2-yl)-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)C1=C(O)C(=O)C(C)(c2cccs2)O1 |
| InChI | InChI=1S/C12H15NO5S2/c1-4-20(16,17)13(3)11-9(14)10(15)12(2,18-11)8-6-5-7-19-8/h5-7,14H,4H2,1-3H3 |
| InChIKey | JDKGWWZOOGMXBV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |