C18H15NO5S — CID 140833945
(2-benzamido-5-methyl-4-oxo-5-thiophen-2-ylfuran-3-yl) acetate (PubChem CID 140833945) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is (2-benzamido-5-methyl-4-oxo-5-thiophen-2-ylfuran-3-yl) acetate.
| Compound Name | (2-benzamido-5-methyl-4-oxo-5-thiophen-2-ylfuran-3-yl) acetate |
|---|---|
| PubChem CID | 140833945 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (2-benzamido-5-methyl-4-oxo-5-thiophen-2-ylfuran-3-yl) acetate |
| SMILES | CC(=O)OC1=C(NC(=O)c2ccccc2)OC(C)(c2cccs2)C1=O |
| InChI | InChI=1S/C18H15NO5S/c1-11(20)23-14-15(21)18(2,13-9-6-10-25-13)24-17(14)19-16(22)12-7-4-3-5-8-12/h3-10H,1-2H3,(H,19,22) |
| InChIKey | TWSSIOPZGOALMW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |