C14H11ClFNO6 — CID 151717686
[3-acetyloxy-5-(2-chloro-6-fluorophenyl)-5-methyl-4-oxofuran-2-yl]carbamic acid (PubChem CID 151717686) has the molecular formula C14H11ClFNO6 and a molecular weight of 343.69 g/mol. Its IUPAC name is [3-acetyloxy-5-(2-chloro-6-fluorophenyl)-5-methyl-4-oxofuran-2-yl]carbamic acid.
| Compound Name | [3-acetyloxy-5-(2-chloro-6-fluorophenyl)-5-methyl-4-oxofuran-2-yl]carbamic acid |
|---|---|
| PubChem CID | 151717686 |
| Molecular Formula | C14H11ClFNO6 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | [3-acetyloxy-5-(2-chloro-6-fluorophenyl)-5-methyl-4-oxofuran-2-yl]carbamic acid |
| SMILES | CC(=O)OC1=C(NC(=O)O)OC(C)(c2c(F)cccc2Cl)C1=O |
| InChI | InChI=1S/C14H11ClFNO6/c1-6(18)22-10-11(19)14(2,23-12(10)17-13(20)21)9-7(15)4-3-5-8(9)16/h3-5,17H,1-2H3,(H,20,21) |
| InChIKey | RHXFEDOSAGZFKN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |