C17H13F2NO6 — CID 140834378
[5-(2,6-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834378) has the molecular formula C17H13F2NO6 and a molecular weight of 365.29 g/mol. Its IUPAC name is [5-(2,6-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(2,6-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834378 |
| Molecular Formula | C17H13F2NO6 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [5-(2,6-difluorophenyl)-2-(2,5-dioxopyrrolidin-1-yl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(N2C(=O)CCC2=O)OC(C)(c2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C17H13F2NO6/c1-8(21)25-14-15(24)17(2,13-9(18)4-3-5-10(13)19)26-16(14)20-11(22)6-7-12(20)23/h3-5H,6-7H2,1-2H3 |
| InChIKey | DXRRJDNTSZXAFK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|