C20H16FNO5 — CID 140834170
[2-benzamido-5-(3-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140834170) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-benzamido-5-(3-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-benzamido-5-(3-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834170 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-benzamido-5-(3-fluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NC(=O)c2ccccc2)OC(C)(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C20H16FNO5/c1-12(23)26-16-17(24)20(2,14-9-6-10-15(21)11-14)27-19(16)22-18(25)13-7-4-3-5-8-13/h3-11H,1-2H3,(H,22,25) |
| InChIKey | HSZNIVGQNXJUGE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |