C20H15F2NO5 — CID 140833950
[2-benzamido-5-(3,5-difluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140833950) has the molecular formula C20H15F2NO5 and a molecular weight of 387.34 g/mol. Its IUPAC name is [2-benzamido-5-(3,5-difluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-benzamido-5-(3,5-difluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140833950 |
| Molecular Formula | C20H15F2NO5 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [2-benzamido-5-(3,5-difluorophenyl)-5-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NC(=O)c2ccccc2)OC(C)(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C20H15F2NO5/c1-11(24)27-16-17(25)20(2,13-8-14(21)10-15(22)9-13)28-19(16)23-18(26)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,23,26) |
| InChIKey | GXJOXQDVDXWHJC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |