C18H17NO6S — CID 140834227
[2-(methanesulfonamido)-5-methyl-5-naphthalen-2-yl-4-oxofuran-3-yl] acetate (PubChem CID 140834227) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is [2-(methanesulfonamido)-5-methyl-5-naphthalen-2-yl-4-oxofuran-3-yl] acetate.
| Compound Name | [2-(methanesulfonamido)-5-methyl-5-naphthalen-2-yl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140834227 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [2-(methanesulfonamido)-5-methyl-5-naphthalen-2-yl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NS(C)(=O)=O)OC(C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C18H17NO6S/c1-11(20)24-15-16(21)18(2,25-17(15)19-26(3,22)23)14-9-8-12-6-4-5-7-13(12)10-14/h4-10,19H,1-3H3 |
| InChIKey | TVDBEKIVFJOBPP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |