C19H18N2O6 — CID 140833877
[2-(ethoxycarbonylamino)-5-methyl-4-oxo-5-quinolin-3-ylfuran-3-yl] acetate (PubChem CID 140833877) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-5-methyl-4-oxo-5-quinolin-3-ylfuran-3-yl] acetate.
| Compound Name | [2-(ethoxycarbonylamino)-5-methyl-4-oxo-5-quinolin-3-ylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 140833877 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(ethoxycarbonylamino)-5-methyl-4-oxo-5-quinolin-3-ylfuran-3-yl] acetate |
| SMILES | CCOC(=O)NC1=C(OC(C)=O)C(=O)C(C)(c2cnc3ccccc3c2)O1 |
| InChI | InChI=1S/C19H18N2O6/c1-4-25-18(24)21-17-15(26-11(2)22)16(23)19(3,27-17)13-9-12-7-5-6-8-14(12)20-10-13/h5-10H,4H2,1-3H3,(H,21,24) |
| InChIKey | CPMCDMAJWAAWST-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |