C19H17NO6S — CID 140833803
[2-(benzenesulfonamido)-5-methyl-4-oxo-5-phenylfuran-3-yl] acetate (PubChem CID 140833803) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is [2-(benzenesulfonamido)-5-methyl-4-oxo-5-phenylfuran-3-yl] acetate.
| Compound Name | [2-(benzenesulfonamido)-5-methyl-4-oxo-5-phenylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 140833803 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2-(benzenesulfonamido)-5-methyl-4-oxo-5-phenylfuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(NS(=O)(=O)c2ccccc2)OC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17NO6S/c1-13(21)25-16-17(22)19(2,14-9-5-3-6-10-14)26-18(16)20-27(23,24)15-11-7-4-8-12-15/h3-12,20H,1-2H3 |
| InChIKey | QEXRCQOAIJUCDQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |