C17H13ClFNO5S — CID 140833834
N-[5-(3-chloro-2-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]benzenesulfonamide (PubChem CID 140833834) has the molecular formula C17H13ClFNO5S and a molecular weight of 397.81 g/mol. Its IUPAC name is N-[5-(3-chloro-2-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]benzenesulfonamide.
| Compound Name | N-[5-(3-chloro-2-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140833834 |
| Molecular Formula | C17H13ClFNO5S |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[5-(3-chloro-2-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]benzenesulfonamide |
| SMILES | CC1(c2cccc(Cl)c2F)OC(NS(=O)(=O)c2ccccc2)=C(O)C1=O |
| InChI | InChI=1S/C17H13ClFNO5S/c1-17(11-8-5-9-12(18)13(11)19)15(22)14(21)16(25-17)20-26(23,24)10-6-3-2-4-7-10/h2-9,20-21H,1H3 |
| InChIKey | RFVAWXOJEIZWAP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |