C12H12FNO5S — CID 140834124
N-[5-(4-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]methanesulfonamide (PubChem CID 140834124) has the molecular formula C12H12FNO5S and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]methanesulfonamide.
| Compound Name | N-[5-(4-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 140834124 |
| Molecular Formula | C12H12FNO5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-[5-(4-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]methanesulfonamide |
| SMILES | CC1(c2ccc(F)cc2)OC(NS(C)(=O)=O)=C(O)C1=O |
| InChI | InChI=1S/C12H12FNO5S/c1-12(7-3-5-8(13)6-4-7)10(16)9(15)11(19-12)14-20(2,17)18/h3-6,14-15H,1-2H3 |
| InChIKey | JUBDSFZTWOOEHW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |