C14H14BrCl2NO5S — CID 140834381
3-bromo-N-[5-(2,6-dichlorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]propane-1-sulfonamide (PubChem CID 140834381) has the molecular formula C14H14BrCl2NO5S and a molecular weight of 459.15 g/mol. Its IUPAC name is 3-bromo-N-[5-(2,6-dichlorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]propane-1-sulfonamide.
| Compound Name | 3-bromo-N-[5-(2,6-dichlorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 140834381 |
| Molecular Formula | C14H14BrCl2NO5S |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 456.92 |
| IUPAC Name | 3-bromo-N-[5-(2,6-dichlorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]propane-1-sulfonamide |
| SMILES | CC1(c2c(Cl)cccc2Cl)OC(NS(=O)(=O)CCCBr)=C(O)C1=O |
| InChI | InChI=1S/C14H14BrCl2NO5S/c1-14(10-8(16)4-2-5-9(10)17)12(20)11(19)13(23-14)18-24(21,22)7-3-6-15/h2,4-5,18-19H,3,6-7H2,1H3 |
| InChIKey | ADJIUZFVGXEZRZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|