C33H48Cl3N3O9S3 — CID 158915765
N-(3-chloro-2-hydroxyphenyl)butane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)octane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)propane-2-sulfonamide (PubChem CID 158915765) has the molecular formula C33H48Cl3N3O9S3 and a molecular weight of 833.32 g/mol. Its IUPAC name is N-(3-chloro-2-hydroxyphenyl)butane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)octane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)propane-2-sulfonamide.
| Compound Name | N-(3-chloro-2-hydroxyphenyl)butane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)octane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 158915765 |
| Molecular Formula | C33H48Cl3N3O9S3 |
| Molecular Weight | 833.32 g/mol |
| Exact Mass | 831.16 |
| IUPAC Name | N-(3-chloro-2-hydroxyphenyl)butane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)octane-1-sulfonamide;N-(3-chloro-2-hydroxyphenyl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cccc(Cl)c1O.CCCCCCCCS(=O)(=O)Nc1cccc(Cl)c1O.CCCCS(=O)(=O)Nc1cccc(Cl)c1O |
| InChI | InChI=1S/C14H22ClNO3S.C10H14ClNO3S.C9H12ClNO3S/c1-2-3-4-5-6-7-11-20(18,19)16-13-10-8-9-12(15)14(13)17;1-2-3-7-16(14,15)12-9-6-4-5-8(11)10(9)13;1-6(2)15(13,14)11-8-5-3-4-7(10)9(8)12/h8-10,16-17H,2-7,11H2,1H3;4-6,12-13H,2-3,7H2,1H3;3-6,11-12H,1-2H3 |
| InChIKey | JHFAIBSJQYSVAB-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.32 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|