C13H13ClFNO5S — CID 140833935
N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]ethanesulfonamide (PubChem CID 140833935) has the molecular formula C13H13ClFNO5S and a molecular weight of 349.77 g/mol. Its IUPAC name is N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]ethanesulfonamide.
| Compound Name | N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 140833935 |
| Molecular Formula | C13H13ClFNO5S |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1=C(O)C(=O)C(C)(c2cc(F)ccc2Cl)O1 |
| InChI | InChI=1S/C13H13ClFNO5S/c1-3-22(19,20)16-12-10(17)11(18)13(2,21-12)8-6-7(15)4-5-9(8)14/h4-6,16-17H,3H2,1-2H3 |
| InChIKey | NTVZHKYZMIFWBR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |