C15H14BrClFNO4 — CID 140834261
4-bromo-N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]butanamide (PubChem CID 140834261) has the molecular formula C15H14BrClFNO4 and a molecular weight of 406.64 g/mol. Its IUPAC name is 4-bromo-N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]butanamide.
| Compound Name | 4-bromo-N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]butanamide |
|---|---|
| PubChem CID | 140834261 |
| Molecular Formula | C15H14BrClFNO4 |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 4-bromo-N-[5-(2-chloro-5-fluorophenyl)-3-hydroxy-5-methyl-4-oxofuran-2-yl]butanamide |
| SMILES | CC1(c2cc(F)ccc2Cl)OC(NC(=O)CCCBr)=C(O)C1=O |
| InChI | InChI=1S/C15H14BrClFNO4/c1-15(9-7-8(18)4-5-10(9)17)13(22)12(21)14(23-15)19-11(20)3-2-6-16/h4-5,7,21H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | SGAGWLZVGIQRPV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|