C14H15BrN2O4 — CID 140834090
4-bromo-N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)butanamide (PubChem CID 140834090) has the molecular formula C14H15BrN2O4 and a molecular weight of 355.19 g/mol. Its IUPAC name is 4-bromo-N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)butanamide.
| Compound Name | 4-bromo-N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)butanamide |
|---|---|
| PubChem CID | 140834090 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-bromo-N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)butanamide |
| SMILES | CC1(c2cccnc2)OC(NC(=O)CCCBr)=C(O)C1=O |
| InChI | InChI=1S/C14H15BrN2O4/c1-14(9-4-3-7-16-8-9)12(20)11(19)13(21-14)17-10(18)5-2-6-15/h3-4,7-8,19H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | HVGVSVXGCYHCHU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|