C17H14N2O4 — CID 140833703
N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)benzamide (PubChem CID 140833703) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)benzamide.
| Compound Name | N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)benzamide |
|---|---|
| PubChem CID | 140833703 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)benzamide |
| SMILES | CC1(c2cccnc2)OC(NC(=O)c2ccccc2)=C(O)C1=O |
| InChI | InChI=1S/C17H14N2O4/c1-17(12-8-5-9-18-10-12)14(21)13(20)16(23-17)19-15(22)11-6-3-2-4-7-11/h2-10,20H,1H3,(H,19,22) |
| InChIKey | RMHVLHIMWMEGGJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |