C12H14N2O5S — CID 140834220
N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)ethanesulfonamide (PubChem CID 140834220) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)ethanesulfonamide.
| Compound Name | N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 140834220 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(3-hydroxy-5-methyl-4-oxo-5-pyridin-3-ylfuran-2-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1=C(O)C(=O)C(C)(c2cccnc2)O1 |
| InChI | InChI=1S/C12H14N2O5S/c1-3-20(17,18)14-11-9(15)10(16)12(2,19-11)8-5-4-6-13-7-8/h4-7,14-15H,3H2,1-2H3 |
| InChIKey | STZLBRGGBRJULL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |