C16H20BrCl2NO5SSi — CID 90080857
3-bromo-N-[5-(2,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide (PubChem CID 90080857) has the molecular formula C16H20BrCl2NO5SSi and a molecular weight of 517.30 g/mol. Its IUPAC name is 3-bromo-N-[5-(2,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide.
| Compound Name | 3-bromo-N-[5-(2,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 90080857 |
| Molecular Formula | C16H20BrCl2NO5SSi |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | 3-bromo-N-[5-(2,4-dichlorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]propane-1-sulfonamide |
| SMILES | C[Si](C)(C)Oc1c(NS(=O)(=O)CCCBr)oc(-c2ccc(Cl)cc2Cl)c1O |
| InChI | InChI=1S/C16H20BrCl2NO5SSi/c1-27(2,3)25-15-13(21)14(11-6-5-10(18)9-12(11)19)24-16(15)20-26(22,23)8-4-7-17/h5-6,9,20-21H,4,7-8H2,1-3H3 |
| InChIKey | SWYLPAJRNPNBRE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|