About 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide
4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide (PubChem CID 140834121) has the molecular formula C19H26BrNO6Si
and a molecular weight of 472.41 g/mol. Its IUPAC name is 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide.
Molecular Properties
| Compound Name | 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
| PubChem CID | 140834121 |
| Molecular Formula | C19H26BrNO6Si |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
| SMILES | COc1ccc(OC)c(-c2oc(NC(=O)CCCBr)c(O[Si](C)(C)C)c2O)c1 |
| InChI | InChI=1S/C19H26BrNO6Si/c1-24-12-8-9-14(25-2)13(11-12)17-16(23)18(27-28(3,4)5)19(26-17)21-15(22)7-6-10-20/h8-9,11,23H,6-7,10H2,1-5H3,(H,21,22) |
| InChIKey | UJNSEAFCZMADPW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide?
The IUPAC name of 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide (CID 140834121) is 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide.
What is the SMILES notation for 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide?
The canonical SMILES for 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide is COc1ccc(OC)c(-c2oc(NC(=O)CCCBr)c(O[Si](C)(C)C)c2O)c1.
What is the InChIKey of 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide?
The InChIKey is UJNSEAFCZMADPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26BrNO6Si/c1-24-12-8-9-14(25-2)13(11-12)17-16(23)18(27-28(3,4)5)19(26-17)21-15(22)7-6-10-20/h8-9,11,23H,6-7,10H2,1-5H3,(H,21,22).
What are the key properties of 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide?
4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide has a molecular weight of 472.41 g/mol, XLogP of 5.00, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide is sourced from PubChem (CID 140834121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).