C19H26BrNO6Si — CID 140834121
4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide (PubChem CID 140834121) has the molecular formula C19H26BrNO6Si and a molecular weight of 472.41 g/mol. Its IUPAC name is 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide.
| Compound Name | 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
|---|---|
| PubChem CID | 140834121 |
| Molecular Formula | C19H26BrNO6Si |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-bromo-N-[5-(2,5-dimethoxyphenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
| SMILES | COc1ccc(OC)c(-c2oc(NC(=O)CCCBr)c(O[Si](C)(C)C)c2O)c1 |
| InChI | InChI=1S/C19H26BrNO6Si/c1-24-12-8-9-14(25-2)13(11-12)17-16(23)18(27-28(3,4)5)19(26-17)21-15(22)7-6-10-20/h8-9,11,23H,6-7,10H2,1-5H3,(H,21,22) |
| InChIKey | UJNSEAFCZMADPW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|