C16H16BrNO5 — CID 90081678
[2-(4-bromobutanoylamino)-4-hydroxy-5-phenylfuran-3-yl] acetate (PubChem CID 90081678) has the molecular formula C16H16BrNO5 and a molecular weight of 382.21 g/mol. Its IUPAC name is [2-(4-bromobutanoylamino)-4-hydroxy-5-phenylfuran-3-yl] acetate.
| Compound Name | [2-(4-bromobutanoylamino)-4-hydroxy-5-phenylfuran-3-yl] acetate |
|---|---|
| PubChem CID | 90081678 |
| Molecular Formula | C16H16BrNO5 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | [2-(4-bromobutanoylamino)-4-hydroxy-5-phenylfuran-3-yl] acetate |
| SMILES | CC(=O)Oc1c(NC(=O)CCCBr)oc(-c2ccccc2)c1O |
| InChI | InChI=1S/C16H16BrNO5/c1-10(19)22-15-13(21)14(11-6-3-2-4-7-11)23-16(15)18-12(20)8-5-9-17/h2-4,6-7,21H,5,8-9H2,1H3,(H,18,20) |
| InChIKey | WMGHDBPUNHCDCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|