C18H24BrNO5Si — CID 90081289
4-bromo-N-[4-hydroxy-5-(3-methoxyphenyl)-3-trimethylsilyloxyfuran-2-yl]butanamide (PubChem CID 90081289) has the molecular formula C18H24BrNO5Si and a molecular weight of 442.38 g/mol. Its IUPAC name is 4-bromo-N-[4-hydroxy-5-(3-methoxyphenyl)-3-trimethylsilyloxyfuran-2-yl]butanamide.
| Compound Name | 4-bromo-N-[4-hydroxy-5-(3-methoxyphenyl)-3-trimethylsilyloxyfuran-2-yl]butanamide |
|---|---|
| PubChem CID | 90081289 |
| Molecular Formula | C18H24BrNO5Si |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 4-bromo-N-[4-hydroxy-5-(3-methoxyphenyl)-3-trimethylsilyloxyfuran-2-yl]butanamide |
| SMILES | COc1cccc(-c2oc(NC(=O)CCCBr)c(O[Si](C)(C)C)c2O)c1 |
| InChI | InChI=1S/C18H24BrNO5Si/c1-23-13-8-5-7-12(11-13)16-15(22)17(25-26(2,3)4)18(24-16)20-14(21)9-6-10-19/h5,7-8,11,22H,6,9-10H2,1-4H3,(H,20,21) |
| InChIKey | SCGRRQAVQAPVFR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|