C17H20BrClFNO4Si — CID 90081408
4-bromo-N-[5-(5-chloro-2-fluorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide (PubChem CID 90081408) has the molecular formula C17H20BrClFNO4Si and a molecular weight of 464.79 g/mol. Its IUPAC name is 4-bromo-N-[5-(5-chloro-2-fluorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide.
| Compound Name | 4-bromo-N-[5-(5-chloro-2-fluorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
|---|---|
| PubChem CID | 90081408 |
| Molecular Formula | C17H20BrClFNO4Si |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 4-bromo-N-[5-(5-chloro-2-fluorophenyl)-4-hydroxy-3-trimethylsilyloxyfuran-2-yl]butanamide |
| SMILES | C[Si](C)(C)Oc1c(NC(=O)CCCBr)oc(-c2cc(Cl)ccc2F)c1O |
| InChI | InChI=1S/C17H20BrClFNO4Si/c1-26(2,3)25-16-14(23)15(11-9-10(19)6-7-12(11)20)24-17(16)21-13(22)5-4-8-18/h6-7,9,23H,4-5,8H2,1-3H3,(H,21,22) |
| InChIKey | FWWMYZSTIQNJHV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|